Распродажа!

4-methyl-1-phenylpentan-1-one CAS 2050-07-9

4-methyl-1-phenylpentan-1-one CAS 2050-07-9 is used as an intermediate in the synthesis of a-Pyrrolidinoisohexanophenone , which is a phenone derivative

4-methyl-1-phenylpentan-1-one CAS 2050-07-9

4-methyl-1-phenylpentan-1-one CAS 2050-07-9

 

4-methyl-1-phenylpentan-1-one 2050-07-9 Usage

Description

4-methyl-1-phenylpentan-1-one, also known as 4-Methyl-valerophenone, is an organic compound that belongs to the class of ketones. It is characterized by the presence of a carbonyl group (C=O) and a methyl group (CH3) attached to the fourth carbon of the pentanone backbone, along with a phenyl group (C6H5) attached to the first carbon. 4-methyl-1-phenylpentan-1-one is known for its unique chemical properties and potential applications in various industries.

Использует

Used in Pharmaceutical Industry:
4-methyl-1-phenylpentan-1-one is used as an intermediate in the synthesis of a-Pyrrolidinoisohexanophenone (Hydrochloride) (P841230), which is a phenone derivative. This derivative is utilized for research purposes, particularly in the development of new pharmaceutical compounds and drugs. The compound plays a crucial role in the synthesis process due to its unique structural features and reactivity.
Used in Chemical Research:
In the field of chemical research, 4-methyl-1-phenylpentan-1-one serves as a valuable compound for studying the properties and reactions of ketones, as well as exploring the potential for new chemical reactions and applications. Its unique structure allows researchers to investigate various aspects of organic chemistry, including the effects of substituents on reactivity and the potential for functional group transformations.
Used in Flavor and Fragrance Industry:
Due to its distinct chemical structure, 4-methyl-1-phenylpentan-1-one may also find applications in the flavor and fragrance industry. The compound could be used as a starting material for the synthesis of various aroma compounds or as a component in the creation of complex fragrances. Its unique scent profile and chemical properties make it a potential candidate for use in the development of new and innovative fragrances.

The CAS Registry Mumber 2050-07-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,0,5 and 0 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2050-07:
(6*2)+(5*0)+(4*5)+(3*0)+(2*0)+(1*7)=39
39 % 10 = 9
So 2050-07-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O/c1-10(2)8-9-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3

Telegram: @sunshine767
Signal: @sunshine.768
whatsapp: +(852)51807114
Threema: M6HU7A2X

Session: 053e1ce88cb18b3f3ea2a3c830116f51bd4d932fefd38ac9b66525bf71a7177d79
Products Website: https://bk4-49851-31-2.com

Отзывы

Отзывов пока нет.

Будьте первым, кто оставил отзыв на “4-methyl-1-phenylpentan-1-one CAS 2050-07-9”

Ваш адрес email не будет опубликован. Обязательные поля помечены *

Отправить запрос сейчас